C25H44IN5O — CID 111619947
1-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111619947) has the molecular formula C25H44IN5O and a molecular weight of 557.57 g/mol. Its IUPAC name is 1-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111619947 |
| Molecular Formula | C25H44IN5O |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN1CCN(CC(C)CN/C(=N\C)NCC2CCCOC2c2ccc(C)cc2)CC1.I |
| InChI | InChI=1S/C25H43N5O.HI/c1-5-29-12-14-30(15-13-29)19-21(3)17-27-25(26-4)28-18-23-7-6-16-31-24(23)22-10-8-20(2)9-11-22;/h8-11,21,23-24H,5-7,12-19H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | HDRYMCFSEBHOQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|