C18H35N3O2S — CID 111141911
2-[(4-butylcyclohexyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111141911) has the molecular formula C18H35N3O2S and a molecular weight of 357.56 g/mol. Its IUPAC name is 2-[(4-butylcyclohexyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[(4-butylcyclohexyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111141911 |
| Molecular Formula | C18H35N3O2S |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-[(4-butylcyclohexyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCCCC1CCC(C/N=C(\NCC)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C18H35N3O2S/c1-3-5-6-15-7-9-16(10-8-15)13-20-18(19-4-2)21-17-11-12-24(22,23)14-17/h15-17H,3-14H2,1-2H3,(H2,19,20,21) |
| InChIKey | ZBTXSPICGQOJLG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|