C19H36IN3O — CID 109443684
N-ethyl-N'-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109443684) has the molecular formula C19H36IN3O and a molecular weight of 449.42 g/mol. Its IUPAC name is N-ethyl-N'-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109443684 |
| Molecular Formula | C19H36IN3O |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-ethyl-N'-[(2-hydroxy-1-methylcyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(C)CCCCC1O)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C19H35N3O.HI/c1-3-20-18(21-14-19(2)11-7-6-10-17(19)23)22-12-15-8-4-5-9-16(15)13-22;/h15-17,23H,3-14H2,1-2H3,(H,20,21);1H |
| InChIKey | CQBMYVUHUINSAV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|