C17H23ClIN5S — CID 111817237
4-(4-chlorophenyl)-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111817237) has the molecular formula C17H23ClIN5S and a molecular weight of 491.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111817237 |
| Molecular Formula | C17H23ClIN5S |
| Molecular Weight | 491.83 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1cnc(CC/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)s1.I |
| InChI | InChI=1S/C17H22ClN5S.HI/c1-13-12-21-16(24-13)6-7-20-17(19)23-10-8-22(9-11-23)15-4-2-14(18)3-5-15;/h2-5,12H,6-11H2,1H3,(H2,19,20);1H |
| InChIKey | DVHNWQHTVBNAHK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|