C19H26ClN5S — CID 111090615
4-(4-chlorophenyl)-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111090615) has the molecular formula C19H26ClN5S and a molecular weight of 391.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111090615 |
| Molecular Formula | C19H26ClN5S |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CC(C)c1nc(CC/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)cs1 |
| InChI | InChI=1S/C19H26ClN5S/c1-14(2)18-23-16(13-26-18)7-8-22-19(21)25-11-9-24(10-12-25)17-5-3-15(20)4-6-17/h3-6,13-14H,7-12H2,1-2H3,(H2,21,22) |
| InChIKey | ORVUSYQLUZHDQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|