C18H24FN5S — CID 110032524
4-(4-fluorophenyl)-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide (PubChem CID 110032524) has the molecular formula C18H24FN5S and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110032524 |
| Molecular Formula | C18H24FN5S |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide |
| SMILES | Cc1csc(C(C)C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C18H24FN5S/c1-13(17-22-14(2)12-25-17)11-21-18(20)24-9-7-23(8-10-24)16-5-3-15(19)4-6-16/h3-6,12-13H,7-11H2,1-2H3,(H2,20,21) |
| InChIKey | VBAAYVFLOLBXFN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|