C17H22FN5OS — CID 111535360
2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111535360) has the molecular formula C17H22FN5OS and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111535360 |
| Molecular Formula | C17H22FN5OS |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NCc1ncc(CC)s1 |
| InChI | InChI=1S/C17H22FN5OS/c1-3-14-9-20-16(25-14)11-22-17(19-4-2)21-10-15(24)23-13-7-5-12(18)6-8-13/h5-9H,3-4,10-11H2,1-2H3,(H,23,24)(H2,19,21,22) |
| InChIKey | DHFSUEINBHIZAG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|