C21H30N4O3S — CID 110057162
N-[2-(furan-2-yl)ethyl]-2,2,3,3-tetramethyl-N'-[(4-sulfamoylphenyl)methyl]azetidine-1-carboximidamide (PubChem CID 110057162) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2,2,3,3-tetramethyl-N'-[(4-sulfamoylphenyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2,2,3,3-tetramethyl-N'-[(4-sulfamoylphenyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057162 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2,2,3,3-tetramethyl-N'-[(4-sulfamoylphenyl)methyl]azetidine-1-carboximidamide |
| SMILES | CC1(C)CN(/C(=N/Cc2ccc(S(N)(=O)=O)cc2)NCCc2ccco2)C1(C)C |
| InChI | InChI=1S/C21H30N4O3S/c1-20(2)15-25(21(20,3)4)19(23-12-11-17-6-5-13-28-17)24-14-16-7-9-18(10-8-16)29(22,26)27/h5-10,13H,11-12,14-15H2,1-4H3,(H,23,24)(H2,22,26,27) |
| InChIKey | RVRMNPQTQAUDHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|