C13H17ClN2O4S — CID 102566699
4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide (PubChem CID 102566699) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 102566699 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)N(C(=O)c1ccc(Cl)cc1)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C13H17ClN2O4S/c1-15(2)16(11-7-21(19,20)8-12(11)17)13(18)9-3-5-10(14)6-4-9/h3-6,11-12,17H,7-8H2,1-2H3 |
| InChIKey | OPONACLBDADSBV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|