C12H14ClNO4S — CID 102566146
4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-methylbenzamide (PubChem CID 102566146) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-methylbenzamide.
| Compound Name | 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 102566146 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-chloro-N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H14ClNO4S/c1-14(10-6-19(17,18)7-11(10)15)12(16)8-2-4-9(13)5-3-8/h2-5,10-11,15H,6-7H2,1H3 |
| InChIKey | NAJSOLVPGACNAL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |