C12H15ClN2O2 — CID 114088799
4-chloro-N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]-N-methylbenzamide (PubChem CID 114088799) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 4-chloro-N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 114088799 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-chloro-N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C12H15ClN2O2/c1-15(10-6-14-7-11(10)16)12(17)8-2-4-9(13)5-3-8/h2-5,10-11,14,16H,6-7H2,1H3/t10-,11-/m0/s1 |
| InChIKey | OHIUODWEWKILQT-QWRGUYRKSA-N |
| XLogP | 0.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |