C12H15N3O4 — CID 43595788
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-3-nitrobenzamide (PubChem CID 43595788) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-3-nitrobenzamide.
| Compound Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43595788 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-3-nitrobenzamide |
| SMILES | CN(C(=O)c1cccc([N+](=O)[O-])c1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C12H15N3O4/c1-14(10-6-13-7-11(10)16)12(17)8-3-2-4-9(5-8)15(18)19/h2-5,10-11,13,16H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | HFLAYCYDSMRJEG-GHMZBOCLSA-N |
| XLogP | -0.00 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|