C12H16N4O4 — CID 43596808
1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methyl-3-(4-nitrophenyl)urea (PubChem CID 43596808) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methyl-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methyl-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 43596808 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-1-methyl-3-(4-nitrophenyl)urea |
| SMILES | CN(C(=O)Nc1ccc([N+](=O)[O-])cc1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C12H16N4O4/c1-15(10-6-13-7-11(10)17)12(18)14-8-2-4-9(5-3-8)16(19)20/h2-5,10-11,13,17H,6-7H2,1H3,(H,14,18)/t10-,11-/m1/s1 |
| InChIKey | JLJJWQPTXYSSQO-GHMZBOCLSA-N |
| XLogP | 0.39 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|