C14H18ClN — CID 124677110
(3R,4S)-3-[(3-chlorophenyl)methyl]-4-cyclopropylpyrrolidine (PubChem CID 124677110) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is (3R,4S)-3-[(3-chlorophenyl)methyl]-4-cyclopropylpyrrolidine.
| Compound Name | (3R,4S)-3-[(3-chlorophenyl)methyl]-4-cyclopropylpyrrolidine |
|---|---|
| PubChem CID | 124677110 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (3R,4S)-3-[(3-chlorophenyl)methyl]-4-cyclopropylpyrrolidine |
| SMILES | Clc1cccc(C[C@H]2CNC[C@H]2C2CC2)c1 |
| InChI | InChI=1S/C14H18ClN/c15-13-3-1-2-10(7-13)6-12-8-16-9-14(12)11-4-5-11/h1-3,7,11-12,14,16H,4-6,8-9H2/t12-,14-/m0/s1 |
| InChIKey | YOAJKOJXFJFMLX-JSGCOSHPSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |