C18H22Cl2O — CID 107311653
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,3-dichlorophenyl)ethanone (PubChem CID 107311653) has the molecular formula C18H22Cl2O and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,3-dichlorophenyl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 107311653 |
| Molecular Formula | C18H22Cl2O |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,3-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1Cl)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H22Cl2O/c19-16-7-3-6-15(18(16)20)11-17(21)14-9-8-12-4-1-2-5-13(12)10-14/h3,6-7,12-14H,1-2,4-5,8-11H2 |
| InChIKey | GLVYQIVWLXHZLM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |