C20H28O — CID 115792612
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,6-dimethylphenyl)ethanone (PubChem CID 115792612) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,6-dimethylphenyl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 115792612 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(2,6-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C)c1CC(=O)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C20H28O/c1-14-6-5-7-15(2)19(14)13-20(21)18-11-10-16-8-3-4-9-17(16)12-18/h5-7,16-18H,3-4,8-13H2,1-2H3 |
| InChIKey | YZBSKKYGOFRJLD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |