C18H24O — CID 114962656
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-methylphenyl)methanone (PubChem CID 114962656) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-methylphenyl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 114962656 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)C2CCC3CCCCC3C2)c1 |
| InChI | InChI=1S/C18H24O/c1-13-5-4-8-16(11-13)18(19)17-10-9-14-6-2-3-7-15(14)12-17/h4-5,8,11,14-15,17H,2-3,6-7,9-10,12H2,1H3 |
| InChIKey | QFJIFHHUXOKESL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |