C19H26O — CID 115788864
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-ethylphenyl)methanone (PubChem CID 115788864) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-ethylphenyl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-ethylphenyl)methanone |
|---|---|
| PubChem CID | 115788864 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(3-ethylphenyl)methanone |
| SMILES | CCc1cccc(C(=O)C2CCC3CCCCC3C2)c1 |
| InChI | InChI=1S/C19H26O/c1-2-14-6-5-9-17(12-14)19(20)18-11-10-15-7-3-4-8-16(15)13-18/h5-6,9,12,15-16,18H,2-4,7-8,10-11,13H2,1H3 |
| InChIKey | DQRFKYQIKHRXEV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |