C15H21NO — CID 116568892
(3-aminocyclohexyl)-(3-ethylphenyl)methanone (PubChem CID 116568892) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3-aminocyclohexyl)-(3-ethylphenyl)methanone.
| Compound Name | (3-aminocyclohexyl)-(3-ethylphenyl)methanone |
|---|---|
| PubChem CID | 116568892 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3-aminocyclohexyl)-(3-ethylphenyl)methanone |
| SMILES | CCc1cccc(C(=O)C2CCCC(N)C2)c1 |
| InChI | InChI=1S/C15H21NO/c1-2-11-5-3-6-12(9-11)15(17)13-7-4-8-14(16)10-13/h3,5-6,9,13-14H,2,4,7-8,10,16H2,1H3 |
| InChIKey | NOOAHKHCYKXEKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |