C19H27Cl2NO4 — CID 22076151
N-(4-tert-butylcyclohexyl)-2-(2,6-dichlorophenyl)acetamide;carbonic acid (PubChem CID 22076151) has the molecular formula C19H27Cl2NO4 and a molecular weight of 404.33 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-2-(2,6-dichlorophenyl)acetamide;carbonic acid.
| Compound Name | N-(4-tert-butylcyclohexyl)-2-(2,6-dichlorophenyl)acetamide;carbonic acid |
|---|---|
| PubChem CID | 22076151 |
| Molecular Formula | C19H27Cl2NO4 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-2-(2,6-dichlorophenyl)acetamide;carbonic acid |
| SMILES | CC(C)(C)C1CCC(NC(=O)Cc2c(Cl)cccc2Cl)CC1.O=C(O)O |
| InChI | InChI=1S/C18H25Cl2NO.CH2O3/c1-18(2,3)12-7-9-13(10-8-12)21-17(22)11-14-15(19)5-4-6-16(14)20;2-1(3)4/h4-6,12-13H,7-11H2,1-3H3,(H,21,22);(H2,2,3,4) |
| InChIKey | SNNRVNWVNHBEMC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |