C19H27ClFNO4 — CID 22076120
N-(4-tert-butylcyclohexyl)-2-(2-chloro-6-fluorophenyl)acetamide;carbonic acid (PubChem CID 22076120) has the molecular formula C19H27ClFNO4 and a molecular weight of 387.88 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-2-(2-chloro-6-fluorophenyl)acetamide;carbonic acid.
| Compound Name | N-(4-tert-butylcyclohexyl)-2-(2-chloro-6-fluorophenyl)acetamide;carbonic acid |
|---|---|
| PubChem CID | 22076120 |
| Molecular Formula | C19H27ClFNO4 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-2-(2-chloro-6-fluorophenyl)acetamide;carbonic acid |
| SMILES | CC(C)(C)C1CCC(NC(=O)Cc2c(F)cccc2Cl)CC1.O=C(O)O |
| InChI | InChI=1S/C18H25ClFNO.CH2O3/c1-18(2,3)12-7-9-13(10-8-12)21-17(22)11-14-15(19)5-4-6-16(14)20;2-1(3)4/h4-6,12-13H,7-11H2,1-3H3,(H,21,22);(H2,2,3,4) |
| InChIKey | OXYGXZBSYAQQMD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |