C18H23ClFNO3 — CID 23374248
methyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-cyclohexylpropanoate (PubChem CID 23374248) has the molecular formula C18H23ClFNO3 and a molecular weight of 355.84 g/mol. Its IUPAC name is methyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-cyclohexylpropanoate.
| Compound Name | methyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-cyclohexylpropanoate |
|---|---|
| PubChem CID | 23374248 |
| Molecular Formula | C18H23ClFNO3 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-cyclohexylpropanoate |
| SMILES | COC(=O)C(C)(NC(=O)Cc1c(F)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C18H23ClFNO3/c1-18(17(23)24-2,12-7-4-3-5-8-12)21-16(22)11-13-14(19)9-6-10-15(13)20/h6,9-10,12H,3-5,7-8,11H2,1-2H3,(H,21,22) |
| InChIKey | CJYJMPGGUFVAKP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |