C13H17ClFNO2 — CID 113343226
2-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2-methylbutan-2-yl)acetamide (PubChem CID 113343226) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 113343226 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2-methylbutan-2-yl)acetamide |
| SMILES | CC(C)(CCO)NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H17ClFNO2/c1-13(2,6-7-17)16-12(18)8-9-10(14)4-3-5-11(9)15/h3-5,17H,6-8H2,1-2H3,(H,16,18) |
| InChIKey | SUXCXFPJEKRVTL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |