C10H7ClFNO4 — CID 2780091
2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-oxoacetic acid (PubChem CID 2780091) has the molecular formula C10H7ClFNO4 and a molecular weight of 259.62 g/mol. Its IUPAC name is 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 2780091 |
| Molecular Formula | C10H7ClFNO4 |
| Molecular Weight | 259.62 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 2-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-2-oxoacetic acid |
| SMILES | O=C(Cc1c(F)cccc1Cl)NC(=O)C(=O)O |
| InChI | InChI=1S/C10H7ClFNO4/c11-6-2-1-3-7(12)5(6)4-8(14)13-9(15)10(16)17/h1-3H,4H2,(H,16,17)(H,13,14,15) |
| InChIKey | YYYYOPOZEYNQMA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|