C16H21Cl2NO — CID 22076137
2-(2,6-dichlorophenyl)-N-(4-ethylcyclohexyl)acetamide (PubChem CID 22076137) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(4-ethylcyclohexyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(4-ethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 22076137 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(4-ethylcyclohexyl)acetamide |
| SMILES | CCC1CCC(NC(=O)Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-2-11-6-8-12(9-7-11)19-16(20)10-13-14(17)4-3-5-15(13)18/h3-5,11-12H,2,6-10H2,1H3,(H,19,20) |
| InChIKey | ZZKHFYXWTIYTSG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |