C11H14Cl2S — CID 83150937
2-chloro-5-(3-chloro-2-cyclopropyl-2-methylpropyl)thiophene (PubChem CID 83150937) has the molecular formula C11H14Cl2S and a molecular weight of 249.21 g/mol. Its IUPAC name is 2-chloro-5-(3-chloro-2-cyclopropyl-2-methylpropyl)thiophene.
| Compound Name | 2-chloro-5-(3-chloro-2-cyclopropyl-2-methylpropyl)thiophene |
|---|---|
| PubChem CID | 83150937 |
| Molecular Formula | C11H14Cl2S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 2-chloro-5-(3-chloro-2-cyclopropyl-2-methylpropyl)thiophene |
| SMILES | CC(CCl)(Cc1ccc(Cl)s1)C1CC1 |
| InChI | InChI=1S/C11H14Cl2S/c1-11(7-12,8-2-3-8)6-9-4-5-10(13)14-9/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | IZIZQGGIUSWEDE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|