C8H17N5O — CID 105235263
[1-ethoxy-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105235263) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is [1-ethoxy-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-ethoxy-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105235263 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | [1-ethoxy-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCOCC(Cc1ncnn1C)NN |
| InChI | InChI=1S/C8H17N5O/c1-3-14-5-7(12-9)4-8-10-6-11-13(8)2/h6-7,12H,3-5,9H2,1-2H3 |
| InChIKey | IOXUSUXLPPNWAP-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|