C16H28N2S2 — CID 105294340
1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)nonylhydrazine (PubChem CID 105294340) has the molecular formula C16H28N2S2 and a molecular weight of 312.55 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)nonylhydrazine.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)nonylhydrazine |
|---|---|
| PubChem CID | 105294340 |
| Molecular Formula | C16H28N2S2 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)nonylhydrazine |
| SMILES | CCCCCCCCC(NN)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C16H28N2S2/c1-2-3-4-5-6-7-8-14(18-17)16-11-13-12-19-10-9-15(13)20-16/h11,14,18H,2-10,12,17H2,1H3 |
| InChIKey | PQUNKKYTNGPBGO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|