C16H19FN2OS — CID 105329255
[(2-fluoro-3-methoxyphenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine (PubChem CID 105329255) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is [(2-fluoro-3-methoxyphenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine.
| Compound Name | [(2-fluoro-3-methoxyphenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105329255 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [(2-fluoro-3-methoxyphenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine |
| SMILES | COc1cccc(C(NN)c2cc3c(s2)CCCC3)c1F |
| InChI | InChI=1S/C16H19FN2OS/c1-20-12-7-4-6-11(15(12)17)16(19-18)14-9-10-5-2-3-8-13(10)21-14/h4,6-7,9,16,19H,2-3,5,8,18H2,1H3 |
| InChIKey | OYRLAJZHDGGDNX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|