C9H16N2OS — CID 105321580
[1-(4,5-dimethylthiophen-2-yl)-2-methoxyethyl]hydrazine (PubChem CID 105321580) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is [1-(4,5-dimethylthiophen-2-yl)-2-methoxyethyl]hydrazine.
| Compound Name | [1-(4,5-dimethylthiophen-2-yl)-2-methoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105321580 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | [1-(4,5-dimethylthiophen-2-yl)-2-methoxyethyl]hydrazine |
| SMILES | COCC(NN)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C9H16N2OS/c1-6-4-9(13-7(6)2)8(11-10)5-12-3/h4,8,11H,5,10H2,1-3H3 |
| InChIKey | GKEUGKLFJGGSCR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|