C9H10Br2N2OS — CID 102840432
2-(4,5-dibromothiophen-2-yl)-2-(3-hydroxypropylamino)acetonitrile (PubChem CID 102840432) has the molecular formula C9H10Br2N2OS and a molecular weight of 354.07 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-2-(3-hydroxypropylamino)acetonitrile.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-2-(3-hydroxypropylamino)acetonitrile |
|---|---|
| PubChem CID | 102840432 |
| Molecular Formula | C9H10Br2N2OS |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-2-(3-hydroxypropylamino)acetonitrile |
| SMILES | N#CC(NCCCO)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H10Br2N2OS/c10-6-4-8(15-9(6)11)7(5-12)13-2-1-3-14/h4,7,13-14H,1-3H2 |
| InChIKey | SPHMKOVARJBROG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|