C9H11BrN2S — CID 61345805
2-(4-bromothiophen-2-yl)-2-(propylamino)acetonitrile (PubChem CID 61345805) has the molecular formula C9H11BrN2S and a molecular weight of 259.17 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(propylamino)acetonitrile.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(propylamino)acetonitrile |
|---|---|
| PubChem CID | 61345805 |
| Molecular Formula | C9H11BrN2S |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(propylamino)acetonitrile |
| SMILES | CCCNC(C#N)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrN2S/c1-2-3-12-8(5-11)9-4-7(10)6-13-9/h4,6,8,12H,2-3H2,1H3 |
| InChIKey | OTPNLDLWWIQJSI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |