C11H12BrFN2 — CID 43364620
2-(4-bromo-2-fluorophenyl)-2-(propylamino)acetonitrile (PubChem CID 43364620) has the molecular formula C11H12BrFN2 and a molecular weight of 271.13 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-2-(propylamino)acetonitrile.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-2-(propylamino)acetonitrile |
|---|---|
| PubChem CID | 43364620 |
| Molecular Formula | C11H12BrFN2 |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-2-(propylamino)acetonitrile |
| SMILES | CCCNC(C#N)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H12BrFN2/c1-2-5-15-11(7-14)9-4-3-8(12)6-10(9)13/h3-4,6,11,15H,2,5H2,1H3 |
| InChIKey | UBCRGYPDVJMKIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |