C13H18N2 — CID 43115225
2-(2,4-dimethylphenyl)-2-(propylamino)acetonitrile (PubChem CID 43115225) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-2-(propylamino)acetonitrile.
| Compound Name | 2-(2,4-dimethylphenyl)-2-(propylamino)acetonitrile |
|---|---|
| PubChem CID | 43115225 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-2-(propylamino)acetonitrile |
| SMILES | CCCNC(C#N)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H18N2/c1-4-7-15-13(9-14)12-6-5-10(2)8-11(12)3/h5-6,8,13,15H,4,7H2,1-3H3 |
| InChIKey | ZIASGDHXKDXTMX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |