C9H13N3OS — CID 104770292
2-(3-hydroxypropylamino)-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 104770292) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-(3-hydroxypropylamino)-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 104770292 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(3-hydroxypropylamino)-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | Cc1csc(C(C#N)NCCCO)n1 |
| InChI | InChI=1S/C9H13N3OS/c1-7-6-14-9(12-7)8(5-10)11-3-2-4-13/h6,8,11,13H,2-4H2,1H3 |
| InChIKey | LUOZAQDEIIXMBZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|