C12H11N3S — CID 104770206
2-anilino-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 104770206) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-anilino-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-anilino-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 104770206 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-anilino-2-(4-methyl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | Cc1csc(C(C#N)Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H11N3S/c1-9-8-16-12(14-9)11(7-13)15-10-5-3-2-4-6-10/h2-6,8,11,15H,1H3 |
| InChIKey | XYYTYUCGIPBNAP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |