C10H13F2NO2 — CID 79492526
1-(2,4-difluorophenyl)-2,2-dimethoxyethanamine (PubChem CID 79492526) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,2-dimethoxyethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 79492526 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,2-dimethoxyethanamine |
| SMILES | COC(OC)C(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H13F2NO2/c1-14-10(15-2)9(13)7-4-3-6(11)5-8(7)12/h3-5,9-10H,13H2,1-2H3 |
| InChIKey | VAWZTCDOIHPBCV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|