C14H21BrN2O2 — CID 103531005
2-(3-bromophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine (PubChem CID 103531005) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(3-bromophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 103531005 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-(3-bromophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine |
| SMILES | COC1CN(C(CN)c2cccc(Br)c2)CC1OC |
| InChI | InChI=1S/C14H21BrN2O2/c1-18-13-8-17(9-14(13)19-2)12(7-16)10-4-3-5-11(15)6-10/h3-6,12-14H,7-9,16H2,1-2H3 |
| InChIKey | AEXVDIUFFPOBIM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |