C13H18ClNO3S — CID 102972079
4-chloro-2-[1-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]phenol (PubChem CID 102972079) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-chloro-2-[1-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]phenol.
| Compound Name | 4-chloro-2-[1-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]phenol |
|---|---|
| PubChem CID | 102972079 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-chloro-2-[1-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]phenol |
| SMILES | CC(c1cc(Cl)ccc1O)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-10(12-9-11(14)3-4-13(12)16)15-5-2-7-19(17,18)8-6-15/h3-4,9-10,16H,2,5-8H2,1H3 |
| InChIKey | BCUQXFLMBFKYQT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|