C17H24N2O3S2 — CID 75393775
1-(1,1-dioxothiolan-3-yl)-3-(2-propan-2-ylsulfanylphenyl)-1-prop-2-enylurea (PubChem CID 75393775) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(2-propan-2-ylsulfanylphenyl)-1-prop-2-enylurea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-propan-2-ylsulfanylphenyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 75393775 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-propan-2-ylsulfanylphenyl)-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccccc1SC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-4-10-19(14-9-11-24(21,22)12-14)17(20)18-15-7-5-6-8-16(15)23-13(2)3/h4-8,13-14H,1,9-12H2,2-3H3,(H,18,20) |
| InChIKey | BVBXDNKAJVWBNE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|