C16H23N3O5S — CID 97319991
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-prop-2-enylurea (PubChem CID 97319991) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-prop-2-enylurea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 97319991 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc(OCCOC)nc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23N3O5S/c1-3-7-19(14-6-10-25(21,22)12-14)16(20)18-13-4-5-15(17-11-13)24-9-8-23-2/h3-5,11,14H,1,6-10,12H2,2H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | XCURMALEESRTQF-AWEZNQCLSA-N |
| XLogP | 1.31 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|