C20H22N2O3S — CID 42387355
1-[(3S)-1,1-dioxothiolan-3-yl]-3-phenyl-1-[(E)-3-phenylprop-2-enyl]urea (PubChem CID 42387355) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-phenyl-1-[(E)-3-phenylprop-2-enyl]urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-phenyl-1-[(E)-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42387355 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-phenyl-1-[(E)-3-phenylprop-2-enyl]urea |
| SMILES | O=C(Nc1ccccc1)N(C/C=C/c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(21-18-11-5-2-6-12-18)22(19-13-15-26(24,25)16-19)14-7-10-17-8-3-1-4-9-17/h1-12,19H,13-16H2,(H,21,23)/b10-7+/t19-/m0/s1 |
| InChIKey | IFLJJXZJAJBTKF-VQFGERMISA-N |
| XLogP | 3.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |