C16H22N2O3S — CID 119950451
3-amino-N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-prop-2-enylpropanamide (PubChem CID 119950451) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-prop-2-enylpropanamide.
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 119950451 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-3-phenyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C(=O)CC(N)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-2-9-18(14-8-10-22(20,21)12-14)16(19)11-15(17)13-6-4-3-5-7-13/h2-7,14-15H,1,8-12,17H2 |
| InChIKey | BTAJRPOAZFUAEC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|