C17H20N2O3S — CID 94668550
N-[(3S)-1,1-dioxothiolan-3-yl]-1-methyl-N-prop-2-enylindole-2-carboxamide (PubChem CID 94668550) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-1-methyl-N-prop-2-enylindole-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-1-methyl-N-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 94668550 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-1-methyl-N-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCN(C(=O)c1cc2ccccc2n1C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20N2O3S/c1-3-9-19(14-8-10-23(21,22)12-14)17(20)16-11-13-6-4-5-7-15(13)18(16)2/h3-7,11,14H,1,8-10,12H2,2H3/t14-/m0/s1 |
| InChIKey | LZGJDHFRFIRNEN-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|