C16H25N3O3S — CID 50952809
N-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylpropyl)-N-prop-2-enylpyrazole-5-carboxamide (PubChem CID 50952809) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylpropyl)-N-prop-2-enylpyrazole-5-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylpropyl)-N-prop-2-enylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50952809 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylpropyl)-N-prop-2-enylpyrazole-5-carboxamide |
| SMILES | C=CCN(C(=O)c1cc(CC(C)C)nn1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H25N3O3S/c1-5-7-19(14-6-8-23(21,22)11-14)16(20)15-10-13(9-12(2)3)17-18(15)4/h5,10,12,14H,1,6-9,11H2,2-4H3 |
| InChIKey | GLBZHHDVUGPEBQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|