C17H23N3OS — CID 131919121
N-cyclopropyl-1-methyl-3-(2-methylpropyl)-N-(thiophen-3-ylmethyl)pyrazole-5-carboxamide (PubChem CID 131919121) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-cyclopropyl-1-methyl-3-(2-methylpropyl)-N-(thiophen-3-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | N-cyclopropyl-1-methyl-3-(2-methylpropyl)-N-(thiophen-3-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131919121 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-cyclopropyl-1-methyl-3-(2-methylpropyl)-N-(thiophen-3-ylmethyl)pyrazole-5-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)N(Cc2ccsc2)C2CC2)n(C)n1 |
| InChI | InChI=1S/C17H23N3OS/c1-12(2)8-14-9-16(19(3)18-14)17(21)20(15-4-5-15)10-13-6-7-22-11-13/h6-7,9,11-12,15H,4-5,8,10H2,1-3H3 |
| InChIKey | PCXYILZVWKPGPO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |