C19H23N3O3S — CID 51124307
N-(1,1-dioxothiolan-3-yl)-5-methyl-1-(2-methylphenyl)-N-prop-2-enylpyrazole-4-carboxamide (PubChem CID 51124307) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-methyl-1-(2-methylphenyl)-N-prop-2-enylpyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-methyl-1-(2-methylphenyl)-N-prop-2-enylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 51124307 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-methyl-1-(2-methylphenyl)-N-prop-2-enylpyrazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1cnn(-c2ccccc2C)c1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23N3O3S/c1-4-10-21(16-9-11-26(24,25)13-16)19(23)17-12-20-22(15(17)3)18-8-6-5-7-14(18)2/h4-8,12,16H,1,9-11,13H2,2-3H3 |
| InChIKey | QLNGWIUVKOMQNB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|