C17H19NO4S — CID 131933758
N-(1,1-dioxothiolan-3-yl)-2-methyl-N-prop-2-enyl-1-benzofuran-7-carboxamide (PubChem CID 131933758) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-methyl-N-prop-2-enyl-1-benzofuran-7-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-methyl-N-prop-2-enyl-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 131933758 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-methyl-N-prop-2-enyl-1-benzofuran-7-carboxamide |
| SMILES | C=CCN(C(=O)c1cccc2cc(C)oc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H19NO4S/c1-3-8-18(14-7-9-23(20,21)11-14)17(19)15-6-4-5-13-10-12(2)22-16(13)15/h3-6,10,14H,1,7-9,11H2,2H3 |
| InChIKey | GCLNSHKICZNEIO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|