C18H20FN3O3S — CID 60560535
N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-5-methyl-N-prop-2-enylpyrazole-4-carboxamide (PubChem CID 60560535) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-5-methyl-N-prop-2-enylpyrazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-5-methyl-N-prop-2-enylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60560535 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-5-methyl-N-prop-2-enylpyrazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1cnn(-c2ccc(F)cc2)c1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20FN3O3S/c1-3-9-21(16-8-10-26(24,25)12-16)18(23)17-11-20-22(13(17)2)15-6-4-14(19)5-7-15/h3-7,11,16H,1,8-10,12H2,2H3 |
| InChIKey | BOYYAJZEQLIJII-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|