C20H20N4O3S2 — CID 60560818
N-(1,1-dioxothiolan-3-yl)-1-phenyl-N-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 60560818) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-phenyl-N-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-phenyl-N-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 60560818 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-phenyl-N-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | C=CCN(C(=O)c1nc(-c2cccs2)n(-c2ccccc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-2-11-23(16-10-13-29(26,27)14-16)20(25)18-21-19(17-9-6-12-28-17)24(22-18)15-7-4-3-5-8-15/h2-9,12,16H,1,10-11,13-14H2 |
| InChIKey | CCXUDMAXIYVGLS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|